CAS 1092347-31-3: 7-Fluoro-2,3-dihydro-4-methoxy-1H-inden-1-one

Description: 7-Fluoro-2,3-dihydro-4-methoxy-1H-inden-1-one is a chemical compound characterized by its unique structural features, including a fluorine atom and a methoxy group attached to an indene derivative. The presence of the fluorine atom typically enhances the compound's biological activity and lipophilicity, which can influence its pharmacological properties. The methoxy group contributes to the compound's overall stability and solubility in organic solvents. This compound is likely to exhibit interesting reactivity due to the presence of the carbonyl group in the indene structure, making it a potential candidate for various chemical transformations. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their therapeutic effects. The specific interactions and behavior of this compound in biological systems would require further investigation through experimental studies to fully understand its potential applications and efficacy.

Formula: C₁₀H₉FO₂

InChI: InChI=1S/C10H9FO2/c1-13-9-5-3-7(11)10-6(9)2-4-8(10)12/h3,5H,2,4H2,1H3

InChI key: InChIKey=IQRUGCAICLCNMX-UHFFFAOYSA-N

SMILES: O=C1C=2C(F)=CC=C(OC)C2CC1

Synonyms:

• 7-Fluoro-2,3-dihydro-4-methoxy-1H-inden-1-one
• 1H-Inden-1-one, 7-fluoro-2,3-dihydro-4-methoxy-

7-Fluoro-4-methoxy-2,3-dihydro-1H-inden-1-one

CAS: 1092347-31-3

• Formula: C₁₀H₉FO₂
• Molecular weight: 180.1757

7-Fluoro-4-methoxy-2,3-dihydro-1H-inden-1-one

CAS: 1092347-31-3

• Purity: 95+%
• Molecular weight: 180.17799377441406

7-Fluoro-4-methoxy-2,3-dihydro-1H-inden-1-one

CAS: 1092347-31-3

Versatile small molecule scaffold

• Formula: C₁₀H₉FO₂
• Purity: Min. 95%
• Molecular weight: 180.17 g/mol