CymitQuimica logo

CAS 1092348-22-5

:

5-Chloro-3,4-dihydro-7-methoxy-1(2H)-naphthalenone

Description:
5-Chloro-3,4-dihydro-7-methoxy-1(2H)-naphthalenone is a chemical compound characterized by its naphthalene core structure, which is modified by the presence of a chlorine atom and a methoxy group. The compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The chlorine substituent typically enhances the compound's electrophilic properties, while the methoxy group can influence its solubility and polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of the dihydro group indicates that the compound may exist in a reduced form, affecting its stability and reactivity. Overall, 5-Chloro-3,4-dihydro-7-methoxy-1(2H)-naphthalenone represents a unique structure that may serve as a valuable scaffold in chemical research and development.
Formula:C11H11ClO2
InChI:InChI=1S/C11H11ClO2/c1-14-7-5-9-8(10(12)6-7)3-2-4-11(9)13/h5-6H,2-4H2,1H3
InChI key:InChIKey=BYKPMJJNUKHTNP-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(OC)=C1)C(=O)CCC2
Synonyms:
  • 5-Chloro-3,4-dihydro-7-methoxy-1(2H)-naphthalenone
  • 1(2H)-Naphthalenone, 5-chloro-3,4-dihydro-7-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.