CymitQuimica logo

CAS 1092349-81-9

:

5,6-Dibromo-3-pyridinecarboxaldehyde

Description:
5,6-Dibromo-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two bromine substituents at the 5 and 6 positions of the pyridine ring significantly influences its chemical properties, including its reactivity and polarity. The carboxaldehyde functional group at the 3-position introduces a reactive aldehyde functionality, making it susceptible to nucleophilic attack and oxidation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the solvent and conditions used. Additionally, the bromine atoms can enhance the compound's electrophilicity, making it useful in coupling reactions or as a building block for more complex molecules. Safety precautions should be taken when handling this compound due to the potential hazards associated with brominated compounds and aldehydes.
Formula:C6H3Br2NO
InChI:InChI=1S/C6H3Br2NO/c7-5-1-4(3-10)2-9-6(5)8/h1-3H
InChI key:InChIKey=PJUYETROJZJHBO-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(Br)C(Br)=NC1
Synonyms:
  • 3-Pyridinecarboxaldehyde, 5,6-dibromo-
  • 2,3-Dibromo-5-pyridinecarboxaldehyde
  • 5,6-Dibromo-3-pyridinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.