CymitQuimica logo

CAS 1092351-88-6

:

methyl 2-methyl-2H-indazole-7-carboxylate

Description:
Methyl 2-methyl-2H-indazole-7-carboxylate, identified by its CAS number 1092351-88-6, is a chemical compound that belongs to the indazole class of compounds. It features a methyl group at the 2-position and a carboxylate ester functional group, which contributes to its reactivity and solubility characteristics. This compound typically exhibits moderate polarity due to the presence of both hydrophobic (methyl and indazole moieties) and hydrophilic (carboxylate) groups. It may be used in various chemical syntheses and research applications, particularly in medicinal chemistry, where indazole derivatives are explored for their biological activities. The compound's structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, its stability and solubility in organic solvents can facilitate its use in laboratory settings. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-12-6-7-4-3-5-8(9(7)11-12)10(13)14-2/h3-6H,1-2H3
InChI key:QHVGFEGPYPLSET-UHFFFAOYSA-N
SMILES:CN1C=C2C=CC=C(C2=N1)C(=O)OC
Found 4 products.