CymitQuimica logo

CAS 1092351-97-7

:

Ethyl 5-amino-3-isoquinolinecarboxylate

Description:
Ethyl 5-amino-3-isoquinolinecarboxylate is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features an amino group (-NH2) at the 5-position and an ethyl ester functional group at the carboxylic acid position. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including coupling reactions in organic synthesis. The ethyl ester moiety contributes to its solubility in organic solvents and may influence its biological activity. This compound is of interest in medicinal chemistry due to its structural features that may interact with biological targets. Additionally, its isoquinoline framework is often associated with pharmacological properties, including anti-inflammatory and anti-cancer activities. As with many organic compounds, the specific reactivity and properties can be influenced by the surrounding environment, including pH and solvent conditions. Overall, Ethyl 5-amino-3-isoquinolinecarboxylate represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-2-16-12(15)11-6-9-8(7-14-11)4-3-5-10(9)13/h3-7H,2,13H2,1H3
InChI key:InChIKey=QPAJEYCTSBLRKS-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=NC(C(OCC)=O)=C2)C=CC1
Synonyms:
  • 3-Isoquinolinecarboxylic acid, 5-amino-, ethyl ester
  • Ethyl 5-amino-3-isoquinolinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.