CAS 1092351-99-9

Ethyl 5-iodo-3-isoquinolinecarboxylate

Description:

Ethyl 5-iodo-3-isoquinolinecarboxylate is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. The presence of the ethyl ester functional group contributes to its reactivity and solubility in organic solvents. The iodine atom at the 5-position of the isoquinoline ring enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit biological activity, as isoquinoline derivatives are known for their pharmacological properties, including antitumor and antimicrobial effects. Its molecular structure suggests that it could participate in further synthetic transformations, making it valuable in medicinal chemistry and organic synthesis. Additionally, the compound's stability and reactivity can be influenced by factors such as solvent choice, temperature, and the presence of other reagents. Overall, Ethyl 5-iodo-3-isoquinolinecarboxylate is a versatile compound with potential applications in both research and industry.

Formula: C₁₂H₁₀INO₂

InChI: InChI=1S/C12H10INO2/c1-2-16-12(15)11-6-9-8(7-14-11)4-3-5-10(9)13/h3-7H,2H2,1H3

InChI key: InChIKey=YCCAPMWTNNYUDB-UHFFFAOYSA-N

SMILES: IC=1C2=C(C=NC(C(OCC)=O)=C2)C=CC1

Synonyms:

• 3-Isoquinolinecarboxylic acid, 5-iodo-, ethyl ester
• Ethyl 5-iodo-3-isoquinolinecarboxylate