CymitQuimica logo

CAS 1092352-35-6

:

5-Chloro-1,6-dihydro-6-oxo-1-(phenylmethyl)-3-pyridinecarboxaldehyde

Description:
5-Chloro-1,6-dihydro-6-oxo-1-(phenylmethyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 5-position and an aldehyde functional group contributes to its reactivity and potential applications in organic synthesis. The compound features a phenylmethyl substituent, which enhances its lipophilicity and may influence its biological activity. The diketone functionality (6-oxo) suggests potential for tautomerization and reactivity in various chemical reactions, including nucleophilic additions. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to interactions with biological targets. Its specific properties, such as solubility, melting point, and stability, would depend on the conditions under which it is studied. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity or reactivity.
Formula:C13H10ClNO2
InChI:InChI=1S/C13H10ClNO2/c14-12-6-11(9-16)8-15(13(12)17)7-10-4-2-1-3-5-10/h1-6,8-9H,7H2
InChI key:InChIKey=HQWQYLKUXAWNRR-UHFFFAOYSA-N
SMILES:C(N1C=C(C=O)C=C(Cl)C1=O)C2=CC=CC=C2
Synonyms:
  • 5-Chloro-1,6-dihydro-6-oxo-1-(phenylmethyl)-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 5-chloro-1,6-dihydro-6-oxo-1-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.