
CAS 1092352-44-7
:Methyl 3,4-dihydro-2,4-dimethyl-3-oxo-2H-1,4-benzoxazine-7-carboxylate
Description:
Methyl 3,4-dihydro-2,4-dimethyl-3-oxo-2H-1,4-benzoxazine-7-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a benzoxazine ring. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups indicates that it may exhibit hydrophobic properties, influencing its solubility in various solvents. The ketone functionality within the structure suggests potential for reactivity in nucleophilic addition reactions. Additionally, the compound may possess biological activity, as many benzoxazine derivatives have been studied for their pharmacological properties. Its molecular structure allows for various substitution patterns, which can be explored for the development of new materials or pharmaceuticals. Overall, this compound represents a unique class of organic molecules with potential utility in both research and industrial applications.
Formula:C12H13NO4
InChI:InChI=1S/C12H13NO4/c1-7-11(14)13(2)9-5-4-8(12(15)16-3)6-10(9)17-7/h4-7H,1-3H3
InChI key:InChIKey=UEYUTFWHRDPPML-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(OC)=O)=CC2)OC(C)C1=O
Synonyms:- 2H-1,4-Benzoxazine-7-carboxylic acid, 3,4-dihydro-2,4-dimethyl-3-oxo-, methyl ester
- Methyl 3,4-dihydro-2,4-dimethyl-3-oxo-2H-1,4-benzoxazine-7-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.