CymitQuimica logo

CAS 1092352-55-0

:

tert-butyl 2-chloro-5H,6H,7H,8H-pyrido[4,3-d]pyrimidine-6-carboxylate

Description:
Tert-butyl 2-chloro-5H,6H,7H,8H-pyrido[4,3-d]pyrimidine-6-carboxylate is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential applications in medicinal chemistry. The presence of a chlorine atom at the 2-position of the pyridine ring introduces reactivity that can be exploited in further chemical transformations. The carboxylate functional group enhances its solubility in polar solvents, making it suitable for various synthetic applications. Its unique structural features may confer biological activity, making it a candidate for drug development or as a biochemical probe. The compound's CAS number, 1092352-55-0, allows for precise identification in chemical databases and literature. Overall, this substance exemplifies the intersection of organic synthesis and pharmacological potential, warranting further investigation into its properties and applications.
Formula:C12H16ClN3O2
InChI:InChI=1S/C12H16ClN3O2/c1-12(2,3)18-11(17)16-5-4-9-8(7-16)6-14-10(13)15-9/h6H,4-5,7H2,1-3H3
InChI key:HBEISXKDRDAGOU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2=NC(=NC=C2C1)Cl
Found 5 products.