CymitQuimica logo

CAS 1092352-66-3

:

3,5,6,7-Tetrahydro-6-(phenylmethyl)-4H-pyrrolo[3,4-d]pyrimidin-4-one

Description:
3,5,6,7-Tetrahydro-6-(phenylmethyl)-4H-pyrrolo[3,4-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrolopyrimidine framework. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturation. The phenylmethyl group attached to the nitrogen atom enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The presence of the pyrimidinone moiety suggests that it may exhibit various pharmacological activities, as many compounds with similar structures are known to interact with biological targets. Additionally, the compound's molecular structure may allow for hydrogen bonding and π-π stacking interactions, which are significant in drug design and molecular recognition. Its specific properties, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, this compound represents a class of molecules that may have potential applications in medicinal chemistry and drug development.
Formula:C13H13N3O
InChI:InChI=1S/C13H13N3O/c17-13-11-7-16(8-12(11)14-9-15-13)6-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,14,15,17)
InChI key:InChIKey=LSTKDSGWHLTBKS-UHFFFAOYSA-N
SMILES:O=C1C2=C(CN(CC3=CC=CC=C3)C2)NC=N1
Synonyms:
  • 3,5,6,7-Tetrahydro-6-(phenylmethyl)-4H-pyrrolo[3,4-d]pyrimidin-4-one
  • 4H-Pyrrolo[3,4-d]pyrimidin-4-one, 3,5,6,7-tetrahydro-6-(phenylmethyl)-
  • 6-Benzyl-3,5,6,7-tetrahydro-4H-pyrrolo[3,4-d]pyrimidin-4-one
  • 6-Benzyl-3,5,6,7-tetrahydropyrrolo[3,4-d]pyriMidin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.