CAS 1092352-69-6

5-[(4-Bromophenyl)amino]-1H-1,2,3-triazole-4-carboxylic acid

Description:

5-[(4-Bromophenyl)amino]-1H-1,2,3-triazole-4-carboxylic acid is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a bromophenyl group that enhances its potential for biological activity. The presence of the amino group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The bromine substituent on the phenyl ring can also affect the compound's electronic properties and steric hindrance, potentially impacting its interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas targeting specific biological pathways. As with many triazole derivatives, it may also possess antifungal or antibacterial properties, although specific biological activities would need to be confirmed through experimental studies.

Formula: C₉H₇BrN₄O₂

InChI: InChI=1S/C9H7BrN4O2/c10-5-1-3-6(4-2-5)11-8-7(9(15)16)12-14-13-8/h1-4H,(H,15,16)(H2,11,12,13,14)

InChI key: InChIKey=LKVPJRWSJMYNPQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(NC2=CC=C(Br)C=C2)N=NN1

Synonyms:

• 1H-1,2,3-Triazole-4-carboxylic acid, 5-[(4-bromophenyl)amino]-
• 5-[(4-Bromophenyl)amino]-1H-1,2,3-triazole-4-carboxylic acid