CAS 1092352-72-1

Methyl 3-amino-5-bromo-6-(2-pyridinyl)thieno[2,3-b]pyridine-2-carboxylate

Description:

Methyl 3-amino-5-bromo-6-(2-pyridinyl)thieno[2,3-b]pyridine-2-carboxylate is a complex organic compound characterized by its unique structural features, which include a thieno[2,3-b]pyridine core, a carboxylate ester functional group, and a bromine atom. This compound exhibits a range of chemical properties typical of heterocyclic compounds, including potential reactivity due to the presence of the amino and bromo substituents. The pyridine ring contributes to its aromatic character, which can influence its solubility and interaction with biological systems. The presence of the methyl ester group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various potential applications, including in the synthesis of more complex molecules or as a pharmacophore in drug design. Overall, this compound represents a significant example of a multifunctional heterocyclic structure in organic chemistry.

Formula: C₁₄H₁₀BrN₃O₂S

InChI: InChI=1S/C14H10BrN3O2S/c1-20-14(19)12-10(16)7-6-8(15)11(18-13(7)21-12)9-4-2-3-5-17-9/h2-6H,16H2,1H3

InChI key: InChIKey=HJMYZPYMFLAYEE-UHFFFAOYSA-N

SMILES: NC=1C=2C(=NC(=C(Br)C2)C3=CC=CC=N3)SC1C(OC)=O

Synonyms:

• Methyl 3-amino-5-bromo-6-(2-pyridinyl)thieno[2,3-b]pyridine-2-carboxylate
• Thieno[2,3-b]pyridine-2-carboxylic acid, 3-amino-5-bromo-6-(2-pyridinyl)-, methyl ester