CymitQuimica logo

CAS 1092367-58-2

:

3-Fluoro-α,2-dihydroxybenzeneacetic acid

Description:
3-Fluoro-α,2-dihydroxybenzeneacetic acid, identified by its CAS number 1092367-58-2, is a chemical compound that features a fluorine atom and two hydroxyl groups attached to a benzene ring, along with an acetic acid moiety. This structure suggests that it may exhibit both acidic and phenolic properties, making it potentially useful in various chemical reactions and applications. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity, often enhancing its lipophilicity and altering its interaction with biological systems. The hydroxyl groups contribute to its ability to form hydrogen bonds, which can affect solubility and reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential pharmacological properties and utility in synthesizing more complex molecules. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise information.
Formula:C8H7FO4
InChI:InChI=1S/C8H7FO4/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,10-11H,(H,12,13)
InChI key:InChIKey=RKLZPKJHTAUPQJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(O)C(F)=CC=C1
Synonyms:
  • Benzeneacetic acid, 3-fluoro-α,2-dihydroxy-
  • 3-Fluoro-α,2-dihydroxybenzeneacetic acid
  • 2-(3-Fluoro-2-hydroxyphenyl)-2-hydroxyacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.