
CAS 1092394-21-2
:1,1-Dimethylethyl N-(5-hydroxy-2-methylphenyl)carbamate
Description:
1,1-Dimethylethyl N-(5-hydroxy-2-methylphenyl)carbamate, identified by its CAS number 1092394-21-2, is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the 5-hydroxy-2-methylphenyl moiety suggests that it may exhibit specific biological activities, possibly related to its phenolic structure, which is known for its antioxidant properties. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the compound may be of interest in various applications, including pharmaceuticals or agrochemicals, due to its potential biological activity. Its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH and temperature. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the context of functionalized aromatic compounds.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-8-5-6-9(14)7-10(8)13-11(15)16-12(2,3)4/h5-7,14H,1-4H3,(H,13,15)
InChI key:InChIKey=XFROHQFECHANML-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(C)C=CC(O)=C1
Synonyms:- Carbamic acid, N-(5-hydroxy-2-methylphenyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-(5-hydroxy-2-methylphenyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.