
CAS 1092443-03-2
:2-Amino[1,2,4]triazolo[1,5-a]pyridin-6-ol
Description:
2-Amino[1,2,4]triazolo[1,5-a]pyridin-6-ol is a heterocyclic compound characterized by the presence of both triazole and pyridine rings in its structure. This compound features an amino group and a hydroxyl group, which contribute to its potential as a bioactive molecule. The triazole ring is known for its stability and ability to participate in hydrogen bonding, while the pyridine ring provides aromaticity and can influence the compound's electronic properties. The presence of the hydroxyl group enhances its solubility in polar solvents and may also play a role in its reactivity and interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its unique structural features allow for potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its properties and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H6N4O
InChI:InChI=1S/C6H6N4O/c7-6-8-5-2-1-4(11)3-10(5)9-6/h1-3,11H,(H2,7,9)
InChI key:InChIKey=RXCDWCXEIJCPDC-UHFFFAOYSA-N
SMILES:NC=1N=C2N(N1)C=C(O)C=C2
Synonyms:- 2-Amino[1,2,4]triazolo[1,5-a]pyridin-6-ol
- [1,2,4]Triazolo[1,5-a]pyridin-6-ol, 2-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.