CAS 1092460-41-7

Methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate

Description:

Methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate, with the CAS number 1092460-41-7, is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with a hydroxyl group and an amino group that is further modified by a trifluoroacetyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the hydroxyl and amide functionalities. The trifluoroacetyl group contributes to its unique chemical behavior, potentially enhancing lipophilicity and influencing its biological activity. Methyl esters, in general, are known for their stability and can participate in various chemical reactions, including hydrolysis and transesterification. The presence of fluorine atoms in the trifluoroacetyl group may also impart distinctive electronic properties, affecting the compound's interaction with biological targets. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile.

Formula: C₁₀H₈F₃NO₄

InChI: InChI=1S/C10H8F3NO4/c1-18-8(16)6-3-2-5(4-7(6)15)14-9(17)10(11,12)13/h2-4,15H,1H3,(H,14,17)

InChI key: InChIKey=COVMHYLZUSIQMC-UHFFFAOYSA-N

SMILES: N(C(C(F)(F)F)=O)C1=CC(O)=C(C(OC)=O)C=C1

Synonyms:

• Methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate
• Benzoic acid, 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]-, methyl ester

METHYL 2-HYDROXY-4-(2,2,2-TRIFLUOROACETAMIDO)BENZOATE

CAS: 1092460-41-7

Formula: C₁₀H₈F₃NO₄

Purity: 95.0%

Molecular weight: 263.172

Ref: 10-F306369