CAS 1092460-57-5

Ethyl 3,4-dihydro-4-[(phenylsulfonyl)methyl]-2H-1,4-benzoxazine-2-carboxylate

Description:

Ethyl 3,4-dihydro-4-[(phenylsulfonyl)methyl]-2H-1,4-benzoxazine-2-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring, an ethyl ester group, and a phenylsulfonyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the benzoxazine moiety suggests that it may possess interesting thermal and chemical properties, making it a candidate for applications in materials science and pharmaceuticals. The sulfonyl group can enhance solubility and reactivity, potentially allowing for further functionalization. Additionally, the ethyl ester group may influence the compound's polarity and interaction with biological systems. Overall, this compound's unique structural features may lead to diverse applications, particularly in the development of novel materials or as intermediates in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.

Formula: C₁₈H₁₉NO₅S

InChI: InChI=1S/C18H19NO5S/c1-2-23-18(20)17-12-19(15-10-6-7-11-16(15)24-17)13-25(21,22)14-8-4-3-5-9-14/h3-11,17H,2,12-13H2,1H3

InChI key: InChIKey=IYKVZJDECNMISW-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)C1=CC=CC=C1)N2C=3C(OC(C(OCC)=O)C2)=CC=CC3

Synonyms:

• 2H-1,4-Benzoxazine-2-carboxylic acid, 3,4-dihydro-4-[(phenylsulfonyl)methyl]-, ethyl ester
• Ethyl 3,4-dihydro-4-[(phenylsulfonyl)methyl]-2H-1,4-benzoxazine-2-carboxylate

ETHYL 4-(PHENYLSULFONYLMETHYL)-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-2-CARBOXYLATE

CAS: 1092460-57-5

Purity: 95.0%

Molecular weight: 361.4100036621094

Ref: 10-F306500