![3-[3-Methyl-5-(trifluoromethyl)phenyl]-2-propenoic acid](https://static.cymitquimica.com/cas-image/203236-3-3-methyl-5-trifluoromethyl-phenyl-2-propenoic-acid.png)
CAS 1092460-62-2: 3-[3-Methyl-5-(trifluoromethyl)phenyl]-2-propenoic acid
Description:3-[3-Methyl-5-(trifluoromethyl)phenyl]-2-propenoic acid, identified by its CAS number 1092460-62-2, is an organic compound characterized by its unique structural features. It contains a propenoic acid moiety, which is a type of unsaturated carboxylic acid, indicating the presence of both a double bond and a carboxylic acid functional group. The compound also features a phenyl ring substituted with a methyl group and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The trifluoromethyl group is known for imparting lipophilicity and enhancing the compound's biological activity, while the methyl group can affect steric hindrance and electronic properties. This compound may exhibit interesting characteristics such as potential acidity due to the carboxylic acid group, and it may participate in various chemical reactions typical of unsaturated acids, including polymerization and esterification. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and development.
Formula:C11H9F3O2
InChI:InChI=1S/C11H9F3O2/c1-7-4-8(2-3-10(15)16)6-9(5-7)11(12,13)14/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=IIMWKXQSZIMHCN-UHFFFAOYSA-N
SMILES:O=C(O)C=CC=1C=C(C=C(C1)C(F)(F)F)C
- Synonyms:
- 3-[3-Methyl-5-(trifluoromethyl)phenyl]-2-propenoic acid
- 2-Propenoic acid, 3-[3-methyl-5-(trifluoromethyl)phenyl]-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Methyl-5-(trifluoromethyl)cinnamic acid REF: 54-PC302313CAS: 1092460-62-2 | 97% | 184.00 €~685.00 € | Mon 31 Mar 25 |
 | 3-Methyl-5-(trifluoromethyl)cinnamic acid REF: 10-F342957CAS: 1092460-62-2 | - - - | - - - | Discontinued product |
 | 3-Methyl-5-(trifluoromethyl)cinnamic acid REF: 3D-STB46062CAS: 1092460-62-2 | Min. 95% | - - - | Discontinued product |
Ref: 54-PC302313
| 1g | 184.00 € | ||
| 5g | 685.00 € |
3-Methyl-5-(trifluoromethyl)cinnamic acid
Ref: 10-F342957
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
3-Methyl-5-(trifluoromethyl)cinnamic acid
Ref: 3D-STB46062
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
