![3-[5-Fluoro-2-(trifluoromethoxy)phenyl]-2-propenoic acid](https://static.cymitquimica.com/cas-image/269938-3-5-fluoro-2-trifluoromethoxy-phenyl-2-propenoic-acid.png)
CAS 1092460-94-0: 3-[5-Fluoro-2-(trifluoromethoxy)phenyl]-2-propenoic acid
Description:3-[5-Fluoro-2-(trifluoromethoxy)phenyl]-2-propenoic acid, identified by its CAS number 1092460-94-0, is an organic compound characterized by its unique molecular structure, which includes a propenoic acid moiety and a phenyl ring substituted with a fluorine atom and a trifluoromethoxy group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its fluorinated structure, which can enhance biological activity and lipophilicity. The presence of the trifluoromethoxy group may contribute to its stability and reactivity, making it of interest in synthetic chemistry. Additionally, the fluorine substituents can influence the compound's electronic properties, potentially affecting its interaction with biological targets. As with many fluorinated compounds, it may exhibit unique solubility characteristics and reactivity patterns compared to non-fluorinated analogs. Safety and handling considerations should be taken into account, as fluorinated compounds can sometimes pose environmental and health risks.
Formula:C10H6F4O3
InChI:InChI=1S/C10H6F4O3/c11-7-2-3-8(17-10(12,13)14)6(5-7)1-4-9(15)16/h1-5H,(H,15,16)
InChI key:InChIKey=KENUZCFTLXSKAK-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC(F)=CC=C1OC(F)(F)F
- Synonyms:
- 3-[5-Fluoro-2-(trifluoromethoxy)phenyl]-2-propenoic acid
- 2-Propenoic acid, 3-[5-fluoro-2-(trifluoromethoxy)phenyl]-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-Fluoro-2-(trifluoromethoxy)cinnamic acid REF: 54-PC302359CAS: 1092460-94-0 | 97% | 134.00 €~920.00 € | Mon 03 Mar 25 |
 | 5-Fluoro-2-(trifluoromethoxy)cinnamic acid REF: 10-F342999CAS: 1092460-94-0 | - - - | - - - | Discontinued product |
 | 5-Fluoro-2-(trifluoromethoxy)cinnamic acid REF: 3D-STB46094CAS: 1092460-94-0 | Min. 95% | - - - | Discontinued product |
5-Fluoro-2-(trifluoromethoxy)cinnamic acid
Ref: 54-PC302359
| 1g | 424.00 € | ||
| 5g | 920.00 € | ||
| 250mg | 134.00 € |
5-Fluoro-2-(trifluoromethoxy)cinnamic acid
Ref: 10-F342999
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
5-Fluoro-2-(trifluoromethoxy)cinnamic acid
Ref: 3D-STB46094
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
