CAS 1092461-17-0
:5-Chloro-2-(trifluoromethoxy)benzoyl chloride
Description:
5-Chloro-2-(trifluoromethoxy)benzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl chloride functional group and a trifluoromethoxy substituent. This compound features a chlorine atom and a trifluoromethoxy group (-O-CF3) attached to the benzene ring, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical applications. As a benzoyl chloride derivative, it is reactive towards nucleophiles, making it useful in acylation reactions. Safety considerations are important, as it can be corrosive and may release toxic gases upon decomposition. Proper handling and storage in a controlled environment are essential to mitigate risks associated with its use.
Formula:C8H3Cl2F3O2
InChI:InChI=1S/C8H3Cl2F3O2/c9-4-1-2-6(15-8(11,12)13)5(3-4)7(10)14/h1-3H
InChI key:InChIKey=LMIAGDMILIYRFG-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(C(Cl)=O)C=C(Cl)C=C1
Synonyms:- 5-Chloro-2-(trifluoromethoxy)benzoyl chloride
- Benzoyl chloride, 5-chloro-2-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Chloro-2-(trifluoromethoxy)benzoyl chloride
CAS:5-Chloro-2-(trifluoromethoxy)benzoyl chlorideFormula:C8H3Cl2F3O2Purity:techColor and Shape:LiquidMolecular weight:259.00942

