CAS 109247-03-2

2-(3,4-dimethoxybenzyl)piperidine hydrochloride

Description:

2-(3,4-Dimethoxybenzyl)piperidine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing ring. The presence of the 3,4-dimethoxybenzyl group indicates that the compound has two methoxy (-OCH3) substituents on a benzyl moiety, contributing to its lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially acting as a neurotransmitter modulator or having effects on the central nervous system, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could interact with various receptors or enzymes, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in research or therapeutic contexts.

Formula: C₁₄H₂₂ClNO₂

InChI: InChI=1/C14H21NO2.ClH/c1-16-13-7-6-11(10-14(13)17-2)9-12-5-3-4-8-15-12;/h6-7,10,12,15H,3-5,8-9H2,1-2H3;1H

SMILES: COc1ccc(CC2CCCCN2)cc1OC.Cl

Synonyms:

• 2-(3,4-Dimethoxybenzyl)piperidine hydrochloride (1:1)

2-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride

CAS: 109247-03-2

2-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride

Purity: ≥95%

Molecular weight: 271.78g/mol

Ref: 54-OR307746

2-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride

Controlled Product

CAS: 109247-03-2

Please enquire for more information about 2-(3,4-Dimethoxy-benzyl)-piperidine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₂₁NO₂·HCl

Purity: Min. 95%

Molecular weight: 271.78 g/mol

Ref: 3D-JEA24703