CymitQuimica logo

CAS 1092523-01-7

:

6-Bromo-1,2,3,4-tetrahydro-2-naphthalenecarbonitrile

Description:
6-Bromo-1,2,3,4-tetrahydro-2-naphthalenecarbonitrile is a chemical compound characterized by its unique structure, which includes a bromine atom and a nitrile functional group attached to a tetrahydronaphthalene framework. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its bicyclic structure. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The nitrile group contributes to its polarity and can participate in further chemical transformations. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. Additionally, its solubility characteristics can vary depending on the solvent used, which is an important consideration for its application in laboratory settings. Overall, 6-Bromo-1,2,3,4-tetrahydro-2-naphthalenecarbonitrile represents a versatile building block in organic synthesis.
Formula:C11H10BrN
InChI:InChI=1S/C11H10BrN/c12-11-4-3-9-5-8(7-13)1-2-10(9)6-11/h3-4,6,8H,1-2,5H2
InChI key:InChIKey=WTDRGPSARBQNGD-UHFFFAOYSA-N
SMILES:C(#N)C1CC=2C(=CC(Br)=CC2)CC1
Synonyms:
  • 6-Bromo-1,2,3,4-tetrahydro-2-naphthalenecarbonitrile
  • 2-Naphthalenecarbonitrile, 6-bromo-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.