
CAS 1092553-18-8
:2,3-Dihydro-4-hydroxy-1H-indene-5-carboxaldehyde
Description:
2,3-Dihydro-4-hydroxy-1H-indene-5-carboxaldehyde, with the CAS number 1092553-18-8, is an organic compound characterized by its unique bicyclic structure, which includes an indene framework. This compound features a hydroxyl group (-OH) and an aldehyde group (-CHO), contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Typically, compounds like this can be involved in various chemical reactions, including oxidation and condensation, making them valuable in the synthesis of more complex organic molecules. Additionally, the compound's structural features may impart specific biological activities, which could be of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2,3-Dihydro-4-hydroxy-1H-indene-5-carboxaldehyde represents a versatile building block in organic chemistry.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c11-6-8-5-4-7-2-1-3-9(7)10(8)12/h4-6,12H,1-3H2
InChI key:InChIKey=JJLVLYOYXXOOBF-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC=C1C=O)CCC2
Synonyms:- 2,3-Dihydro-4-hydroxy-1H-indene-5-carboxaldehyde
- 1H-Indene-5-carboxaldehyde, 2,3-dihydro-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.