CAS 1092555-03-7

1H-12,13c-Methanopyrano[4′,3′,2′:1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,6,7,7a,8,10,11,12,13,13a,13b-dodecahydro-11-methyl-14-oxo-, methyl ester, 9-oxide, (7aS,9R,11S,12R,13aR,13bS,13cS)-

Description:

The chemical substance known as "1H-12,13c-Methanopyrano[4′,3′,2′:1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,6,7,7a,8,10,11,12,13,13a,13b-dodecahydro-11-methyl-14-oxo-, methyl ester, 9-oxide, (7aS,9R,11S,12R,13aR,13bS,13cS)-" with CAS number 1092555-03-7 is a complex organic compound characterized by its intricate polycyclic structure. This compound features multiple fused rings, including pyrano, azulene, and indolizine moieties, which contribute to its unique chemical properties. The presence of various functional groups, such as carboxylic acid and ester functionalities, suggests potential reactivity and solubility characteristics that may be influenced by the stereochemistry indicated by its chiral centers. The compound's methyl ester form implies it may exhibit different solubility and reactivity compared to its acid counterpart. Overall, this substance is likely to be of interest in fields such as medicinal chemistry or materials science due to its structural complexity and potential biological activity.

Formula: C₂₃H₂₉NO₅

InChI: InChI=1S/C23H29NO5/c1-12-10-24(27)11-13-4-5-17-19-14(6-7-29-17)16(21(26)28-3)9-23(19)20(25)15(12)8-18(24)22(13,23)2/h12-13,15,18H,4-11H2,1-3H3/t12-,13-,15-,18-,22-,23+,24-/m1/s1

InChI key: InChIKey=OHPSOIUFKKLGIW-AWVORQCJSA-N

SMILES: C[C@@]12[C@]34C=5C(=C(C(OC)=O)C3)CCOC5CC[C@@]1(CN6(=O)[C@@]2(C[C@@](C4=O)([C@H](C)C6)[H])[H])[H]

Synonyms:

• 1H-12,13c-Methanopyrano[4′,3′,2′:1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,6,7,7a,8,10,11,12,13,13a,13b-dodecahydro-11-methyl-14-oxo-, methyl ester, 9-oxide, (7aS,9R,11S,12R,13aR,13bS,13cS)-
• Daphnilongeranine A N-oxide
• Paxiphylline E

Paxiphylline E

CAS: 1092555-03-7

Paxiphylline E is a natural product of Daphniphyllum, Daphniphyllaceae.

Formula: C₂₃H₂₉NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 399.48

Ref: TM-TN4745

Paxiphylline E

CAS: 1092555-03-7

Formula: C₂₃H₂₉NO₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 399.487

Ref: BP-SBP01455

Paxiphylline E

CAS: 1092555-03-7

Paxiphylline E is a bioactive compound derived from natural plant sources. It functions primarily as a modulatory agent impacting specific biochemical pathways, particularly those involving inflammatory mediators. The mode of action of Paxiphylline E involves the inhibition of key enzymes within these pathways, leading to a reduction in inflammatory responses. This bioactivity suggests that the compound may alter cellular communication and modulate immune system responses, offering therapeutic potential for conditions involving inflammation.

Formula: C₂₃H₂₉NO₅

Purity: Min. 95%

Molecular weight: 399.5 g/mol

Ref: 3D-STB55503