CAS 1092563-82-0
:8-Bromo-2(1H)-quinoxalinone
Description:
8-Bromo-2(1H)-quinoxalinone is a chemical compound characterized by its quinoxaline core, which is a bicyclic structure containing two nitrogen atoms. This compound features a bromine substituent at the 8-position and a carbonyl group at the 2-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the bromine atom can enhance its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. 8-Bromo-2(1H)-quinoxalinone has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structure allows for interactions with various biological macromolecules, which may lead to therapeutic effects. As with many heterocyclic compounds, it is important to handle this substance with care, considering its potential toxicity and the need for appropriate safety measures during experimentation.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-5-2-1-3-6-8(5)11-7(12)4-10-6/h1-4H,(H,11,12)
InChI key:InChIKey=JHXVDOCODXRKOJ-UHFFFAOYSA-N
SMILES:BrC1=C2C(N=CC(=O)N2)=CC=C1
Synonyms:- 2(1H)-Quinoxalinone, 8-bromo-
- 8-Bromo-2(1H)-quinoxalinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
