CymitQuimica logo

CAS 1092564-37-8

:

[2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholinylmethanone

Description:
[2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholinylmethanone is a complex organic compound characterized by its unique structural features, including a difluorophenyl group and a morpholinylmethanone moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a building block in the synthesis of pharmaceuticals. The difluorination enhances the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. Morpholine, a cyclic amine, contributes to the compound's solubility and may enhance its pharmacokinetic properties. This compound is likely to exhibit moderate to high stability under standard conditions, although specific stability and reactivity would depend on environmental factors such as temperature and pH. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C17H22BF2NO4
InChI:InChI=1S/C17H22BF2NO4/c1-16(2)17(3,4)25-18(24-16)11-9-12(19)14(13(20)10-11)15(22)21-5-7-23-8-6-21/h9-10H,5-8H2,1-4H3
InChI key:InChIKey=UCDGUXSFPQFWNW-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(C=C1F)B2OC(C)(C)C(C)(C)O2)N3CCOCC3
Synonyms:
  • Methanone, [2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholinyl-
  • [2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-morpholinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.