
CAS 1092565-44-0
:5-[8-(1H-Pyrazol-4-yl)-1,5-naphthyridin-2-yl]-3-pyridinesulfonamide
Description:
5-[8-(1H-Pyrazol-4-yl)-1,5-naphthyridin-2-yl]-3-pyridinesulfonamide is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a pyrazole moiety, and a sulfonamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its diverse functional groups. The presence of the sulfonamide group suggests possible applications in medicinal chemistry, particularly as a scaffold for drug development, given its ability to interact with biological targets. The pyrazole and naphthyridine components may contribute to its pharmacological properties, potentially influencing its solubility, stability, and reactivity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in pharmaceutical research and development.
Formula:C16H12N6O2S
InChI:InChI=1S/C16H12N6O2S/c17-25(23,24)12-5-10(6-18-9-12)14-1-2-15-16(22-14)13(3-4-19-15)11-7-20-21-8-11/h1-9H,(H,20,21)(H2,17,23,24)
InChI key:InChIKey=GTWOKQIGBJADIZ-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(C2=NC=3C(=CC=NC3C=C2)C=4C=NNC4)=CN=C1
Synonyms:- 5-[8-(1H-Pyrazol-4-yl)-1,5-naphthyridin-2-yl]-3-pyridinesulfonamide
- 3-Pyridinesulfonamide, 5-[8-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MMV024101
CAS:<p>MMV024101: PI4K inhibitor, P. falciparum NF54 IC50 543 nM, poor solubility (<5 μM), fast mouse liver clearance.</p>Formula:C16H12N6O2SColor and Shape:SolidMolecular weight:352.37
