CymitQuimica logo

CAS 1092580-91-0

:

1H-Pyrrolo[2,3-b]pyridine, 5-bromo-, 7-oxide

Description:
1H-Pyrrolo[2,3-b]pyridine, 5-bromo-, 7-oxide is a heterocyclic organic compound characterized by a fused bicyclic structure that includes both pyrrole and pyridine rings. The presence of a bromine atom at the 5-position and an oxide group at the 7-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit properties such as moderate solubility in organic solvents. Its structure suggests potential biological activity, making it of interest in drug discovery and development. The presence of the bromine atom can enhance the compound's lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the oxide functionality may participate in various chemical reactions, including oxidation and nucleophilic attacks. As with many heterocycles, this compound may also exhibit interesting electronic properties due to the delocalization of electrons within its aromatic system. Overall, 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-, 7-oxide represents a valuable scaffold for further research in organic and medicinal chemistry.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-6-3-5-1-2-9-7(5)10(11)4-6/h1-4,9H
InChI key:InChIKey=HDLSIKCINXNWPW-UHFFFAOYSA-N
SMILES:O=N1=C2C(=CC(Br)=C1)C=CN2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-, 7-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.