CAS 1092581-00-4

2-(4-Chloro-5-fluoro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-(4-Chloro-5-fluoro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, which include a dioxaborolane ring and a substituted aromatic moiety. The presence of the chloro and fluoro substituents on the aromatic ring contributes to its potential reactivity and solubility properties, while the methoxy group can influence its electronic characteristics and steric hindrance. This compound is typically used in organic synthesis, particularly in cross-coupling reactions, due to the boron atom's ability to form stable complexes with various nucleophiles. Its dioxaborolane structure enhances its stability and reactivity in chemical transformations. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Overall, its unique combination of functional groups and structural features makes it a valuable compound in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₇BClFO₃

InChI: InChI=1S/C13H17BClFO3/c1-12(2)13(3,4)19-14(18-12)8-6-10(16)9(15)7-11(8)17-5/h6-7H,1-5H3

InChI key: InChIKey=JMZBYWPPHMGDQQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(F)C(Cl)=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 2-(4-Chloro-5-fluoro-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 1,3,2-Dioxaborolane, 2-(4-chloro-5-fluoro-2-methoxyphenyl)-4,4,5,5-tetramethyl-