
CAS 1092682-87-5
:4-Chloro-3-methyl-1H-pyrazole
Description:
4-Chloro-3-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms. The presence of a chlorine atom at the 4-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents. It exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases. 4-Chloro-3-methyl-1H-pyrazole is often utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the electron-withdrawing nature of the chlorine atom, which can influence its behavior in nucleophilic substitution reactions. Additionally, the compound's potential biological activity makes it of interest in medicinal chemistry, although specific applications may vary based on ongoing research and development.
Formula:C4H5ClN2
InChI:InChI=1S/C4H5ClN2/c1-3-4(5)2-6-7-3/h2H,1H3,(H,6,7)
InChI key:InChIKey=LCDKUXJKMAFCTI-UHFFFAOYSA-N
SMILES:ClC=1C(C)=NNC1
Synonyms:- 4-Chloro-3-methyl-1H-pyrazole
- Pyrazole, 4-chloro-3(or 5)-methyl-
- 4-Chloro-3-methylpyrazole
- Pyrazole, 4-chloro-3-methyl-
- 1H-Pyrazole, 4-chloro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.