CymitQuimica logo

CAS 1092712-21-4

:

1-(2,3-Difluorophenyl)-2,2,2-trifluoroethanone

Description:
1-(2,3-Difluorophenyl)-2,2,2-trifluoroethanone is an organic compound characterized by its unique fluorinated structure, which contributes to its chemical properties and potential applications. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it resistant to degradation. This compound features a ketone functional group, which is indicative of its reactivity in various chemical reactions, particularly in nucleophilic additions. The difluorophenyl moiety introduces additional electronic effects, influencing the compound's reactivity and interaction with biological systems. Due to its fluorinated nature, it may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and material science. Furthermore, the compound's molecular structure suggests potential applications in agrochemicals or as intermediates in the synthesis of more complex fluorinated compounds. However, specific safety and handling guidelines should be followed due to the presence of fluorine, which can pose environmental and health risks. Overall, 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethanone represents a significant compound in the realm of fluorinated organic chemistry.
Formula:C8H3F5O
InChI:InChI=1S/C8H3F5O/c9-5-3-1-2-4(6(5)10)7(14)8(11,12)13/h1-3H
InChI key:InChIKey=YJJOYDXULMKYLC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(F)C(F)=CC=C1
Synonyms:
  • 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethanone
  • 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethan-1-one
  • Ethanone, 1-(2,3-difluorophenyl)-2,2,2-trifluoro-
Found 3 products.