
CAS 109274-98-8
:Furo[2,3-b]pyridine-3-carboxamide
Description:
Furo[2,3-b]pyridine-3-carboxamide is a heterocyclic organic compound characterized by its fused furan and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxamide functional group, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of both aromatic and heteroaromatic systems in its structure imparts stability and influences its reactivity, making it of interest in medicinal chemistry and material science. Furo[2,3-b]pyridine derivatives are often studied for their biological activities, including potential anti-inflammatory and antimicrobial properties. The compound's molecular structure allows for various substitution patterns, which can be explored to optimize its pharmacological profile. Additionally, its CAS number, 109274-98-8, serves as a unique identifier for regulatory and safety information. Overall, Furo[2,3-b]pyridine-3-carboxamide exemplifies the complexity and versatility of heterocyclic compounds in chemical research and applications.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c9-7(11)6-4-12-8-5(6)2-1-3-10-8/h1-4H,(H2,9,11)
InChI key:InChIKey=WRJDMGHOBCKBJC-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=2C(OC1)=NC=CC2
Synonyms:- Furo[2,3-b]pyridine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.