CAS 1092790-24-3
:B-(1,2-Dihydro-2-oxo-6-quinolinyl)boronic acid
Description:
B-(1,2-Dihydro-2-oxo-6-quinolinyl)boronic acid is a boronic acid derivative characterized by its unique structure, which includes a quinoline moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the quinoline ring contributes to its potential biological activity, as quinolines are known for their pharmacological properties. Additionally, this compound may exhibit moderate solubility in polar solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in the formation of carbon-carbon bonds. Its boronic acid functionality allows it to act as a Lewis acid, facilitating interactions with nucleophiles. Overall, B-(1,2-Dihydro-2-oxo-6-quinolinyl)boronic acid is a versatile compound with potential applications in drug development and materials science, owing to its unique structural features and reactivity.
Formula:C9H8BNO3
InChI:InChI=1S/C9H8BNO3/c12-9-4-1-6-5-7(10(13)14)2-3-8(6)11-9/h1-5,13-14H,(H,11,12)
InChI key:InChIKey=WQYHFDIBGLFSRR-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C2C(NC(=O)C=C2)=CC1
Synonyms:- (2-Hydroxyquinolin-6-yl)boronic acid
- B-(1,2-Dihydro-2-oxo-6-quinolinyl)boronic acid
- Boronic acid, B-(1,2-dihydro-2-oxo-6-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
