CAS 1092791-48-4

4,5-Dibromo-1H-pyrazole-3-carboxylic acid hydrazide

Description:

4,5-Dibromo-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of bromine substituents at the 4 and 5 positions of the pyrazole ring contributes to its reactivity and potential biological activity. The carboxylic acid functional group at the 3 position, along with the hydrazide moiety, enhances its ability to participate in various chemical reactions, including hydrazone formation and potential coordination with metal ions. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical and agricultural research. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 4,5-Dibromo-1H-pyrazole-3-carboxylic acid hydrazide represents a versatile structure for further exploration in synthetic and medicinal chemistry.

Formula: C₄H₄Br₂N₄O

InChI: InChI=1S/C4H4Br2N4O/c5-1-2(4(11)8-7)9-10-3(1)6/h7H2,(H,8,11)(H,9,10)

InChI key: InChIKey=CAMYPJCFMIMITE-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C(Br)=C(Br)NN1

Synonyms:

• 4,5-Dibromo-1H-pyrazole-3-carboxylic acid hydrazide
• 1H-Pyrazole-3-carboxylic acid, 4,5-dibromo-, hydrazide