
CAS 1092797-60-8
:1,4-Benzodioxin-6-methanamine, 2,3-dihydro-α-propyl-, hydrochloride (1:1)
Description:
1,4-Benzodioxin-6-methanamine, 2,3-dihydro-α-propyl-, hydrochloride (1:1), with CAS number 1092797-60-8, is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxin moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts, as indicated by its hydrochloride form. The presence of the α-propyl group suggests potential hydrophobic characteristics, which may influence its solubility and interaction with biological systems. The hydrochloride salt form enhances its stability and solubility in aqueous environments, making it suitable for various applications, including pharmaceutical formulations. Additionally, compounds of this nature may exhibit biological activity, potentially acting as intermediates in synthetic pathways or as active pharmaceutical ingredients. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and related fields.
Formula:C12H17NO2·ClH
InChI:InChI=1S/C12H17NO2.ClH/c1-2-3-10(13)9-4-5-11-12(8-9)15-7-6-14-11;/h4-5,8,10H,2-3,6-7,13H2,1H3;1H
InChI key:InChIKey=LUAIJGNHDQWSJP-UHFFFAOYSA-N
SMILES:C(CCC)(N)C=1C=C2C(=CC1)OCCO2.Cl
Synonyms:- 1,4-Benzodioxin-6-methanamine, 2,3-dihydro-α-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.