
CAS 1092797-77-7
:Benzenepropanamine, 2-chloro-α-methyl-, hydrochloride (1:1)
Description:
Benzenepropanamine, 2-chloro-α-methyl-, hydrochloride (1:1), also known by its CAS number 1092797-77-7, is a chemical compound characterized by its amine functional group and a chloro substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the chloro group and the α-methyl substituent contributes to its unique chemical reactivity and potential biological activity. As an amine, it may participate in various chemical reactions, including alkylation and acylation, and can act as a base in acid-base reactions. Its structural features suggest potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity. Always refer to material safety data sheets (MSDS) for detailed safety information.
Formula:C10H14ClN·ClH
InChI:InChI=1S/C10H14ClN.ClH/c1-8(12)6-7-9-4-2-3-5-10(9)11;/h2-5,8H,6-7,12H2,1H3;1H
InChI key:InChIKey=NVCYSMVSGDVJQR-UHFFFAOYSA-N
SMILES:C(CC(C)N)C1=C(Cl)C=CC=C1.Cl
Synonyms:- Benzenepropanamine, 2-chloro-α-methyl-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
SK 609New
CAS:SK 609New is a dopamine receptor agonist that has been shown to increase locomotor activity in mice. It also binds to the dopaminergic receptors and is able to inhibit the production of hydrogen chloride (HCl) in mammalian cells. SK 609New is not toxic to human cells, which may be due to its ability to bind peptides, but it does show an affinity for S. pyogenes and S. agalactiae, which are streptococcus species. SK 609New has been shown to stimulate the release of dopamine and can reduce locomotor activity in rats with Parkinson's disease-like symptoms.Formula:C10H14ClN·HClPurity:Min. 95%Molecular weight:220.14 g/molSK609 HCl
CAS:SK609 HCl is a selective dopamine D3 receptor agonist. It also has atypical signaling properties.Formula:C10H15Cl2NPurity:99.02%Color and Shape:SolidMolecular weight:220.14



