
CAS 1092844-00-2
:N-[5-Cyano-4-(4-fluorophenyl)-6-(1-methylethyl)-2-pyrimidinyl]-N-methylmethanesulfonamide
Description:
N-[5-Cyano-4-(4-fluorophenyl)-6-(1-methylethyl)-2-pyrimidinyl]-N-methylmethanesulfonamide, identified by its CAS number 1092844-00-2, is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring substituted with a cyano group, a fluorophenyl moiety, and an isopropyl group. This compound features a sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. The presence of the cyano and fluorine substituents may enhance its lipophilicity and influence its interaction with biological targets. Typically, compounds of this nature are investigated for their potential as therapeutic agents, particularly in the fields of oncology or infectious diseases, due to their ability to interfere with specific biochemical pathways. Additionally, the sulfonamide group can contribute to the compound's solubility and stability in various environments. As with many synthetic compounds, understanding its properties, including solubility, stability, and reactivity, is crucial for its application in research and development.
Formula:C16H17FN4O2S
InChI:InChI=1S/C16H17FN4O2S/c1-10(2)14-13(9-18)15(11-5-7-12(17)8-6-11)20-16(19-14)21(3)24(4,22)23/h5-8,10H,1-4H3
InChI key:InChIKey=FBPIJENARXXHQH-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=NC(N(S(C)(=O)=O)C)=NC1C(C)C)C2=CC=C(F)C=C2
Synonyms:- Methanesulfonamide, N-[5-cyano-4-(4-fluorophenyl)-6-(1-methylethyl)-2-pyrimidinyl]-N-methyl-
- N-[5-Cyano-4-(4-fluorophenyl)-6-(1-methylethyl)-2-pyrimidinyl]-N-methylmethanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

