CAS 109293-98-3
:DIFLUFENZOPYR SODIUM SALT
Description:
Diflufenzo-pyr sodium salt is a chemical compound primarily used as a herbicide in agricultural applications. It belongs to the class of pyridine carboxylic acids and functions by inhibiting specific enzymes involved in the biosynthesis of certain plant hormones, thereby disrupting the growth of target weeds. The compound is characterized by its high solubility in water, which facilitates its application in various formulations. Its mode of action is selective, targeting broadleaf weeds while being less harmful to cereal crops. Diflufenzo-pyr sodium salt is typically applied pre-emergence or post-emergence, depending on the specific weed management strategy. Safety data indicates that, while it is effective against a range of weeds, appropriate handling and application practices are essential to minimize environmental impact and ensure safety for non-target organisms. As with many agrochemicals, regulatory assessments are conducted to evaluate its environmental fate, toxicity, and potential for bioaccumulation.
Formula:C15H11F2N4O3·Na
InChI:InChI=1/C15H12F2N4O3.Na/c1-8(13-12(14(22)23)3-2-4-18-13)20-21-15(24)19-11-6-9(16)5-10(17)7-11;/h2-7H,1H3,(H,22,23)(H2,19,21,24);/q;+1/p-1/b20-8+;
InChI key:InChIKey=XGRQKGWFIUSSHG-UHFFFAOYSA-N
SMILES:C(=NNC(NC1=CC(F)=CC(F)=C1)=O)(C)C2=C(C(O)=O)C=CC=N2.[Na]
Synonyms:- 3-Pyridinecarboxylic acid, 2-[1-[2-[[(3,5-difluorophenyl)amino]carbonyl]hydrazinylidene]ethyl]-, sodium salt (1:1)
- 3-Pyridinecarboxylic acid, 2-[1-[[[(3,5-difluorophenyl)amino]carbonyl]hydrazono]ethyl]-, monosodium salt
- Diflufenopyr Sodium Salt
- Diflufenzopyr-sodium
- sodium 2-[(1E)-1-{2-[(3,5-difluorophenyl)carbamoyl]hydrazinylidene}ethyl]pyridine-3-carboxylate
- Diufenzopyr sodium salt
- C12631032 Diflufenzopyr sodium
- Chloridazon Impurity 12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diflufenzopyr sodium
CAS:Controlled ProductFormula:C15H11F2N4O3·NaColor and Shape:NeatMolecular weight:356.26
