CAS 1092952-64-1

(1S)-2-Hydroxy-1-[(S)-hydroxy(7-methoxy-2-oxo-2H-1-benzopyran-6-yl)methyl]-2-methylpropyl (2Z)-2-methyl-2-butenoate

Description:

(1S)-2-Hydroxy-1-[(S)-hydroxy(7-methoxy-2-oxo-2H-1-benzopyran-6-yl)methyl]-2-methylpropyl (2Z)-2-methyl-2-butenoate is a complex organic compound characterized by its unique structural features, including multiple functional groups such as hydroxyl, methoxy, and ester moieties. This compound belongs to the class of flavonoids, which are known for their diverse biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. The presence of the benzopyran structure contributes to its potential pharmacological effects. The stereochemistry indicated by the (1S) and (S) designations suggests specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can be affected by its functional groups and overall molecular structure. As with many organic compounds, its behavior in various environments, such as in solvents or biological systems, can provide insights into its potential applications in pharmaceuticals or nutraceuticals. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₀H₂₄O₇

InChI: InChI=1S/C20H24O7/c1-6-11(2)19(23)27-18(20(3,4)24)17(22)13-9-12-7-8-16(21)26-14(12)10-15(13)25-5/h6-10,17-18,22,24H,1-5H3/b11-6-/t17-,18-/m0/s1

InChI key: InChIKey=GFMYIOGFYYHKLA-MKWBBVNXSA-N

SMILES: [C@H]([C@H](OC(/C(=C\C)/C)=O)C(C)(C)O)(O)C1=C(OC)C=C2C(=C1)C=CC(=O)O2

Synonyms:

• (1S)-2-Hydroxy-1-[(S)-hydroxy(7-methoxy-2-oxo-2H-1-benzopyran-6-yl)methyl]-2-methylpropyl (2Z)-2-methyl-2-butenoate
• 2-Butenoic acid, 2-methyl-, (1S)-2-hydroxy-1-[(S)-hydroxy(7-methoxy-2-oxo-2H-1-benzopyran-6-yl)methyl]-2-methylpropyl ester, (2Z)-
• Angelol M

Angelol M

CAS: 1092952-64-1

Angelol M shows activity in inhibiting prostate specific antigen (PSA) secreted from androgen dependent prostate cancer cell line, LNCaP cells.

Formula: C₂₀H₂₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 376.4

Ref: TM-TN3416

Angelol M

CAS: 1092952-64-1

Angelol M is a therapeutic product, derived from natural plant sources. It is composed of bioactive compounds that are primarily extracted from the essential oils of various medicinal plants. These compounds are known for their multifaceted mode of action, including the modulation of inflammatory pathways and potential antioxidant activities.

Formula: C₂₀H₂₄O₇

Purity: Min. 95%

Molecular weight: 376.40 g/mol

Ref: 3D-STB95264