CAS 109296-41-5

2,2-Dimethyl-1-(4-methylphenyl)cyclopropanamine

Description:

2,2-Dimethyl-1-(4-methylphenyl)cyclopropanamine, identified by its CAS number 109296-41-5, is a chemical compound characterized by its cyclopropane structure, which features a three-membered carbon ring. This compound contains two methyl groups attached to the cyclopropane, enhancing its steric bulk, and a para-substituted methylphenyl group, which contributes to its aromatic characteristics. The presence of an amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The specific arrangement of substituents can affect the compound's physical properties, such as melting and boiling points, as well as its potential interactions with biological systems. Additionally, the compound's stereochemistry may play a crucial role in its pharmacological profile, influencing how it interacts with biological targets. Overall, 2,2-Dimethyl-1-(4-methylphenyl)cyclopropanamine represents a unique structure with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₂H₁₇N

InChI: InChI=1S/C12H17N/c1-9-4-6-10(7-5-9)12(13)8-11(12,2)3/h4-7H,8,13H2,1-3H3

InChI key: InChIKey=DJQABQMYJQDLPN-UHFFFAOYSA-N

SMILES: NC1(C(C)(C)C1)C2=CC=C(C)C=C2

Synonyms:

• 2,2-Dimethyl-1-(4-methylphenyl)cyclopropanamine
• 2,2-Dimethyl-1-(4-methylphenyl)cyclopropylamine
• 2,2-Dimethyl-1-(4-methylphenyl)cyclopropan-1-amine
• Cyclopropanamine, 2,2-dimethyl-1-(4-methylphenyl)-