CymitQuimica logo

CAS 1092960-99-0

:

1H-Pyrrolo[2,3-c]pyridin-3-amine

Description:
1H-Pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nitrogen atom in the pyridine ring, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure allows for potential interactions with biological targets, which has garnered interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the amino group at the 3-position enhances its reactivity and solubility in polar solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings, which can influence its behavior in electronic applications. As with many heterocycles, it may also participate in hydrogen bonding, affecting its interactions in biological systems. Overall, 1H-Pyrrolo[2,3-c]pyridin-3-amine is a versatile compound with potential applications in drug discovery and materials science.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c8-6-3-10-7-4-9-2-1-5(6)7/h1-4,10H,8H2
InChI key:InChIKey=MTAGMTOPEMBFJT-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CN=CC2)NC1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridin-3-amine
  • 3-Amino-6-azaindole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.