CAS 1092961-09-5: 1H-Indazole-7-methanol
Description:1H-Indazole-7-methanol, identified by its CAS number 1092961-09-5, is a chemical compound that features a fused indazole ring structure with a hydroxymethyl group at the 7-position. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of the hydroxymethyl group introduces a functional site that can participate in various chemical reactions, such as oxidation or substitution, making it a versatile intermediate in organic synthesis. Additionally, the indazole moiety is known for its biological activity, which may include anti-inflammatory and anticancer properties, although specific biological data for this compound may vary. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxymethyl group. Its unique structure and functional groups make it of interest in medicinal chemistry and material science, where it could serve as a building block for more complex molecules or as a potential therapeutic agent.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c11-5-7-3-1-2-6-4-9-10-8(6)7/h1-4,11H,5H2,(H,9,10)
InChI key:InChIKey=CDFSPQVWOQHSMO-UHFFFAOYSA-N
SMILES:OCC1=CC=CC=2C=NNC21
- Synonyms:
- (1H-Indazol-7-yl)-methanol
- 1H-Indazole-7-methanol

(1H-indazol-7-yl)methanol
Ref: IN-DA008U2A
1g | 74.00 € | ||
5g | 183.00 € | ||
100mg | 31.00 € | ||
250mg | 39.00 € |

(1H-Indazol-7-yl)methanol
Ref: 10-F224238
1g | 43.00 € | ||
5g | 189.00 € | ||
10g | 348.00 € | ||
250mg | 20.00 € |

Ref: 54-OR30860
Undefined size | To inquire |

7-(Hydroxymethyl)-1H-indazole
Ref: 3D-STB96109
2500mg | 448.00 € |