CAS 109299-78-7
:5-Pyrimidinylboronic acid
Description:
5-Pyrimidinylboronic acid is an organoboron compound characterized by the presence of a pyrimidine ring and a boronic acid functional group. Its molecular structure features a six-membered aromatic ring containing nitrogen atoms, which contributes to its heterocyclic nature. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. It exhibits properties that allow it to participate in Suzuki-Miyaura cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Additionally, 5-pyrimidinylboronic acid can act as a ligand in coordination chemistry and has potential applications in drug development due to its ability to interact with biological targets. Its reactivity and functional versatility make it a significant compound in both academic research and industrial applications.
Formula:C4H5BN2O2
InChI:InChI=1/C4H5BN2O2/c8-5(9)4-1-6-3-7-2-4/h1-3,8-9H
SMILES:c1c(cncn1)B(O)O
Synonyms:- Boronic acid, 5-pyrimidinyl-
- Pyrimidine-5-Boronic
- Pyrimidinyl-5-Boronic Acid
- 5-Pyrimidylboronic Acid (contains varying amounts of Anhydride)
- Pyrimidin-5-Ylboronic Acid
- 5-Pyrimidineboronic acid
- Pyrimidine-5-boronic acid
- 5-Pyrimidylboronic Acid
- Akos Brn-0205
- Dihydroxy(5-Pyrimidinyl)Borane
- 5-Pyrimidine Boronic Acid
- (Pyrimidin-5-Yl)Boronic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Pyrimidylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H5BN2O2Purity:95.0 to 117.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:123.91Pyrimidine-5-boronic acid
CAS:Formula:C4H5BN2O2Purity:97%Color and Shape:SolidMolecular weight:123.9057Pyrimidine-5-boronic acid
CAS:Formula:C4H5BN2O2Purity:≥ 98.0%Color and Shape:White to off-white solidMolecular weight:123.91Pyrimidine-5-boronic acid
CAS:<p>Pyrimidine-5-boronic acid</p>Formula:C4H5BN2O2Purity:98%Color and Shape: white solidMolecular weight:123.91g/molPyrimidine-5-boronic acid
CAS:Formula:C4H5BN2O2Purity:97%Color and Shape:Solid, White powderMolecular weight:123.915-Pyrimidylboronic Acid
CAS:Controlled Product<p>Applications 5-Pyrimidylboronic Acid, is one of the new heteroarylpyrimidine derivatives via Suzuki cross-coupling reactions.<br>References Saygili N, et al.: Org Biomol Chem. 2004 Mar 21;2(6):852-7. Epub 2004 Feb 23.<br></p>Formula:C4H5BN2O2Color and Shape:NeatMolecular weight:123.91






