CymitQuimica logo

CAS 109305-66-0

:

[(3-CHLORO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYL CYANOCARBONIMIDODITHIOATE

Description:
The chemical substance known as [(3-chloro-1,2,4-thiadiazol-5-ylthio)methyl] methyl cyanocarbonimidodithioate, with the CAS number 109305-66-0, is a complex organic compound featuring a thiadiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen atoms. This compound is characterized by the presence of a chloro substituent, which can influence its reactivity and biological activity. The thiol and cyanocarbonimidodithioate functional groups suggest potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to their ability to interact with biological systems. The presence of multiple sulfur atoms may also impart unique properties, such as increased stability or specific interactions with metal ions. Overall, this compound's structure indicates it may exhibit significant biological activity, making it of interest for further research in both synthetic and applied chemistry contexts. However, detailed studies would be necessary to fully understand its properties, mechanisms of action, and potential applications.
Formula:C6H5ClN4S4
InChI:InChI=1/C6H5ClN4S4/c1-12-5(9-2-8)13-3-14-6-10-4(7)11-15-6/h3H2,1H3/b9-5+
Synonyms:
  • [(3-Chloro-1,2,4-thiadiazol-5-ylthio)methyl]
  • [(3-Chloro-1,2,4-Thiadiazol-5-Yl)Sulfanyl]Methyl Methyl Cyanodithioimidocarbonate
  • [(3-CHLORO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYL CYANOCARBONIMIDODITHIOATE
  • (3-chloro-1,2,4-thiadiazol-5-yl)sulfanylmethylsulfanyl-methylsulfanylmethylidene]cyanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.