CAS 1093060-48-0

4-Methyl-5-(3-methylphenyl)-1H-pyrazol-3-amine

Description:

4-Methyl-5-(3-methylphenyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a 3-methylphenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group (-NH2) suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could impart biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 4-Methyl-5-(3-methylphenyl)-1H-pyrazol-3-amine represents a class of compounds that can be explored for various applications in research and industry.

Formula: C₁₁H₁₃N₃

InChI: InChI=1S/C11H13N3/c1-7-4-3-5-9(6-7)10-8(2)11(12)14-13-10/h3-6H,1-2H3,(H3,12,13,14)

InChI key: InChIKey=JHXUWBQDUNNEEH-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C)=CC=C2)NN=C1N

Synonyms:

• 1H-Pyrazol-3-amine, 4-methyl-5-(3-methylphenyl)-
• 4-Methyl-5-(3-methylphenyl)-1H-pyrazol-3-amine