CymitQuimica logo

CAS 1093173-58-0

:

4-(3-Bromopropyl)-2-methylthiophene

Description:
4-(3-Bromopropyl)-2-methylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromopropyl group at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The thiophene ring provides aromatic stability, while the alkyl substituents can influence its solubility and interaction with other molecules. It may be used in various applications, including organic synthesis, materials science, and potentially in the development of pharmaceuticals or agrochemicals. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C8H11BrS
InChI:InChI=1S/C8H11BrS/c1-7-5-8(6-10-7)3-2-4-9/h5-6H,2-4H2,1H3
InChI key:InChIKey=NMTFNZZRCVGDQT-UHFFFAOYSA-N
SMILES:C(CCBr)C=1C=C(C)SC1
Synonyms:
  • 4-(3-Bromopropyl)-2-methylthiophene
  • Thiophene, 4-(3-bromopropyl)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.