CymitQuimica logo

CAS 109324-81-4

:

1H-Pyrrolo[1,2-a][1,4]diazepin-1-one,octahydro-(9CI)

Description:
1H-Pyrrolo[1,2-a][1,4]diazepin-1-one, octahydro- (CAS 109324-81-4) is a bicyclic compound characterized by its unique fused ring structure, which includes a pyrrole and diazepine moiety. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of nitrogen atoms in its rings. The octahydro designation indicates that the compound is fully saturated, which influences its stability and reactivity compared to unsaturated analogs. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of multiple nitrogen atoms can also contribute to hydrogen bonding capabilities, affecting its interactions with other molecules. Overall, this compound's structural features suggest potential applications in various fields, including drug design and synthesis, although specific biological activities and applications would require further investigation.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c11-8-7-3-1-5-10(7)6-2-4-9-8/h7H,1-6H2,(H,9,11)
InChI key:XODXWMXYGYWAQL-UHFFFAOYSA-N
SMILES:C1CC2C(=O)NCCCN2C1
Found 0 products.