
CAS 109324-82-5
:Ethyl 1-(3-aminopropyl)-2-piperidinecarboxylate
Description:
Ethyl 1-(3-aminopropyl)-2-piperidinecarboxylate, with the CAS number 109324-82-5, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl ester functional group and an aminoalkyl side chain, specifically a 3-aminopropyl group, which contributes to its potential biological activity. The presence of the amino group suggests that it may engage in hydrogen bonding and interact with various biological targets, making it of interest in medicinal chemistry. Ethyl 1-(3-aminopropyl)-2-piperidinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, and its reactivity can be influenced by the functional groups present. This compound may be studied for its pharmacological properties, particularly in relation to its potential as a drug candidate or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H22N2O2
InChI:InChI=1S/C11H22N2O2/c1-2-15-11(14)10-6-3-4-8-13(10)9-5-7-12/h10H,2-9,12H2,1H3
InChI key:InChIKey=YTFYFWODGCAORH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1N(CCCN)CCCC1
Synonyms:- 2-Piperidinecarboxylic acid, 1-(3-aminopropyl)-, ethyl ester
- Ethyl 1-(3-aminopropyl)-2-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.