CymitQuimica logo

CAS 109333-31-5

:

1,3,7,8-tetrabromooxanthrene

Description:
1,3,7,8-Tetrabromooxanthrene is a polycyclic aromatic compound characterized by the presence of four bromine atoms attached to an oxanthrene structure. This compound typically exhibits a complex molecular geometry due to the arrangement of its aromatic rings and bromine substituents, which can influence its electronic properties and reactivity. The presence of bromine atoms enhances its hydrophobicity and can affect its solubility in various solvents. Additionally, the bromination can impart unique photophysical properties, making it of interest in applications such as organic electronics and materials science. The compound may also exhibit fluorescence, which is a characteristic feature of many polycyclic aromatic compounds. Due to the presence of multiple bromine atoms, 1,3,7,8-tetrabromooxanthrene may have implications for environmental chemistry and toxicology, as brominated compounds can exhibit persistence and bioaccumulation in ecosystems. Safety data sheets should be consulted for handling and disposal guidelines, as brominated compounds can pose health risks.
Formula:C12H4Br4O2
InChI:InChI=1/C12H4Br4O2/c13-5-1-8(16)12-11(2-5)17-9-3-6(14)7(15)4-10(9)18-12/h1-4H
SMILES:c1c(cc2c(c1Br)Oc1cc(c(cc1O2)Br)Br)Br
Synonyms:
  • 1,3,7,8-Tetrabromo-Dibenzo-P-Dioxin
  • Dibenzo[B,E][1,4]Dioxin, 1,3,7,8-Tetrabromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.