CAS 109333-33-7
:2-bromo-3,7,8-trichlorooxanthrene
Description:
2-Bromo-3,7,8-trichlorooxanthrene is a synthetic organic compound characterized by its complex halogenated structure. It belongs to the class of polycyclic aromatic compounds, specifically oxanthrenes, which are known for their aromaticity and potential applications in various fields, including materials science and organic electronics. The presence of bromine and multiple chlorine substituents significantly influences its chemical reactivity and physical properties, such as solubility and stability. Typically, compounds like this may exhibit fluorescence, making them useful in photonic applications. Additionally, the halogen substituents can enhance the compound's resistance to degradation, but they may also raise concerns regarding environmental persistence and toxicity. The compound's molecular structure suggests potential interactions with biological systems, necessitating careful handling and assessment of its safety profile. Overall, 2-bromo-3,7,8-trichlorooxanthrene exemplifies the intricate balance between functionality and environmental considerations in the design of halogenated organic compounds.
Formula:C12H4BrCl3O2
InChI:InChI=1/C12H4BrCl3O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H
SMILES:c1c(c(cc2c1Oc1cc(c(cc1O2)Cl)Cl)Cl)Br
Synonyms:- 2-Bromo-3,7,8-trichlorodibenzo(b,e)(1,4)dioxin
- 2-Bromo-3,7,8-trichlorodibenzo-p-dioxin
- Dibenzo(b,e)(1,4)dioxin, 2-bromo-3,7,8-trichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.